okilactomycin structure
|
Common Name | okilactomycin | ||
|---|---|---|---|---|
| CAS Number | 111367-04-5 | Molecular Weight | 416.50700 | |
| Density | 1.22g/cm3 | Boiling Point | 618.3ºC at 760mmHg | |
| Molecular Formula | C24H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of okilactomycinOkilactomycin is a lactone group antibiotic isolated from the culture filtrate of a strain of actinomycetes (Streptomyces species)[1]. |
| Name | okilactomycin |
|---|---|
| Synonym | More Synonyms |
| Description | Okilactomycin is a lactone group antibiotic isolated from the culture filtrate of a strain of actinomycetes (Streptomyces species)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 618.3ºC at 760mmHg |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.50700 |
| Exact Mass | 416.22000 |
| PSA | 89.90000 |
| LogP | 3.69420 |
| Vapour Pressure | 7.08E-17mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | KQZIMLFKBWIOJJ-ZRHSTDQJSA-N |
| SMILES | C=C1C(=O)C2(C)C(=O)OC34CC(C)C(C(=O)O)=CC3CCCC(C)CC(C)C1OC24 |
| (3R,3aR,5R,6R,8R,11aS,14S,15aS)-3,3a,5,6,7,8,9,10,11,11a,14,15-Dodecahydro-3,6,8,14-tetramethyl-16-methylene-2,17-dioxo-3,5-ethano-2H-furo[2,3-o][2]benzoxacycloundecin-13-carboxylic acid |