2-AMINO-3,5-DIIODOBENZOICACID
Modify Date: 2025-09-17 18:08:54
2-AMINO-3,5-DIIODOBENZOICACID structure
|
Common Name | 2-AMINO-3,5-DIIODOBENZOICACID | ||
|---|---|---|---|---|
| CAS Number | 111203-08-8 | Molecular Weight | 210.19200 | |
| Density | 1.32g/cm3 | Boiling Point | 485.6ºC at 760 mmHg | |
| Molecular Formula | C11H6N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.5ºC | |
| Name | (2e)-3-(5-amino-4-cyano-2-furyl)prop-2-enylidene]malononitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 485.6ºC at 760 mmHg |
| Molecular Formula | C11H6N4O |
| Molecular Weight | 210.19200 |
| Flash Point | 247.5ºC |
| Exact Mass | 210.05400 |
| PSA | 110.53000 |
| LogP | 2.30144 |
| Vapour Pressure | 1.39E-09mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | BCTKTBOSNGKAEA-HNQUOIGGSA-N |
| SMILES | N#CC(C#N)=CC=Cc1cc(C#N)c(N)o1 |
| HS Code | 2932190090 |
|---|
|
~4%
2-AMINO-3,5-DII... CAS#:111203-08-8 |
| Literature: Marchalin, Stefan; Ilavsky, Dusan; Kovac, Jaroslav; Bruncko, Milan Collection of Czechoslovak Chemical Communications, 1990 , vol. 55, # 3 p. 718 - 727 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-(5-amino-2-methylphenyl)-2-phenyl-2,3-dihydroisoindol-1-one |
| 5-(5-amino-4-cyano-2-furyl)-2-cyano-2,4-pentadienenitrile |
| 1H-Isoindol-1-one,5-(5-amino-2-methylphenyl)-2,3-dihydro-2-phenyl |