benzo[e][1]benzothiole 3,3-dioxide
Modify Date: 2025-08-27 06:31:13
![benzo[e][1]benzothiole 3,3-dioxide Structure](https://image.chemsrc.com/caspic/136/110973-64-3.png)
benzo[e][1]benzothiole 3,3-dioxide structure
|
Common Name | benzo[e][1]benzothiole 3,3-dioxide | ||
|---|---|---|---|---|
| CAS Number | 110973-64-3 | Molecular Weight | 216.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzo[e][1]benzothiole 3,3-dioxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8O2S |
|---|---|
| Molecular Weight | 216.25600 |
| Exact Mass | 216.02500 |
| PSA | 42.52000 |
| LogP | 3.67860 |
| InChIKey | DNYOHMDBPIPORA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CS3(=O)=O |
|
~%
benzo[e][1]benz... CAS#:110973-64-3 |
| Literature: Davies; Porter Journal of the Chemical Society, 1956 , p. 2609,2613 |
![1,2-dihydrobenzo[e][1]benzothiole 3,3-dioxide structure](https://image.chemsrc.com/caspic/483/5324-61-8.png)
![2-bromo-1,2-dihydro-naphtho[2,1-b]thiophene-3,3-dioxide structure](https://image.chemsrc.com/caspic/487/108952-94-9.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Naphtho[2,1-b]thiophen-3,3-dioxid |
| naphtho[2,1-b]thiophene-3,3-dioxide |