4-(2,3-Dichloro-phenyl)-2,6-dimethyl-1,4-dihydro-pyridine-3,5-dicarboxylic acid 3-(2-cyano-ethyl) ester 5-methyl ester
Modify Date: 2025-08-26 17:18:19
4-(2,3-Dichloro-phenyl)-2,6-dimethyl-1,4-dihydro-pyridine-3,5-dicarboxylic acid 3-(2-cyano-ethyl) ester 5-methyl ester structure
|
Common Name | 4-(2,3-Dichloro-phenyl)-2,6-dimethyl-1,4-dihydro-pyridine-3,5-dicarboxylic acid 3-(2-cyano-ethyl) ester 5-methyl ester | ||
|---|---|---|---|---|
| CAS Number | 110962-94-2 | Molecular Weight | 409.263 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 552.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H18Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.0±30.1 °C | |
| Name | 5-O-(2-cyanoethyl) 3-O-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 552.6±50.0 °C at 760 mmHg |
| Molecular Formula | C19H18Cl2N2O4 |
| Molecular Weight | 409.263 |
| Flash Point | 288.0±30.1 °C |
| Exact Mass | 408.064362 |
| PSA | 88.42000 |
| LogP | 3.94 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | IVCOGJGSSDCCEZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCC#N)C1c1cccc(Cl)c1Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Cyanoethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate |
| cyanoethyl methyl 4-(2',3'-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| 3,5-Pyridinedicarboxylic acid, 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-, 2-cyanoethyl methyl ester |
| 4-(2,3-Dichloro-phenyl)-2,6-dimethyl-1,4-dihydro-pyridine-3,5-dicarboxylic acid 3-(2-cyano-ethyl) ester 5-methyl ester |
| Clevidipine Impurity 14 |