2-chloro-N'-(2-methyl-4-oxoquinazolin-3-yl)-N-phenyliminobenzenecarboximidamide structure
|
Common Name | 2-chloro-N'-(2-methyl-4-oxoquinazolin-3-yl)-N-phenyliminobenzenecarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 110605-05-5 | Molecular Weight | 401.84800 | |
| Density | 1.3g/cm3 | Boiling Point | 564.1ºC at 760mmHg | |
| Molecular Formula | C22H16ClN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295ºC | |
| Name | 2-chloro-N'-(2-methyl-4-oxoquinazolin-3-yl)-N-phenyliminobenzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 564.1ºC at 760mmHg |
| Molecular Formula | C22H16ClN5O |
| Molecular Weight | 401.84800 |
| Flash Point | 295ºC |
| Exact Mass | 401.10400 |
| PSA | 71.97000 |
| LogP | 5.35210 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | FQFRJVBDORJDDS-OBWOFCCJSA-N |
| SMILES | Cc1nc2ccccc2c(=O)n1N=C(N=Nc1ccccc1)c1ccccc1Cl |
|
~%
2-chloro-N'-(2-... CAS#:110605-05-5 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 26, # 1-12 p. 368 - 370 |
|
~%
2-chloro-N'-(2-... CAS#:110605-05-5 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 26, # 1-12 p. 368 - 370 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4(3H)-Quinazolinone,3-(((2-chlorophenyl)(phenylazo)methylene)amino)-2-methyl |
| 3-(((2-Chlorophenyl)(phenylazo)methylene)amino)-2-methyl-4(3H)-quinazolinone |