2-(5-(benzo[d][1,3]dioxol-5-yl)isoxazol-3-yl)-N-(thiophen-2-ylmethyl)acetamide structure
|
Common Name | 2-(5-(benzo[d][1,3]dioxol-5-yl)isoxazol-3-yl)-N-(thiophen-2-ylmethyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 1105206-07-2 | Molecular Weight | 342.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5-(benzo[d][1,3]dioxol-5-yl)isoxazol-3-yl)-N-(thiophen-2-ylmethyl)acetamide |
|---|
| Molecular Formula | C17H14N2O4S |
|---|---|
| Molecular Weight | 342.4 |
| InChIKey | PSKYAJYXGWLXLS-UHFFFAOYSA-N |
| SMILES | O=C(Cc1cc(-c2ccc3c(c2)OCO3)on1)NCc1cccs1 |
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_HPP
|