1-Benzyl 4-tert-butyl 6-(hydroxymethyl)-1,4-diazepane-1,4-dicarboxylate structure
|
Common Name | 1-Benzyl 4-tert-butyl 6-(hydroxymethyl)-1,4-diazepane-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1105187-33-4 | Molecular Weight | 364.436 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 496.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C19H28N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.3±25.9 °C | |
| Name | 1-Benzyl 4-tert-butyl 6-(hydroxymethyl)-1,4-diazepane-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 496.8±35.0 °C at 760 mmHg |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.436 |
| Flash Point | 254.3±25.9 °C |
| Exact Mass | 364.199829 |
| PSA | 79.31000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | UINDULZNDFPHNC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)CC(CO)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-1,4-Diazepine-1,4(5H)-dicarboxylic acid, tetrahydro-6-(hydroxymethyl)-, 1,1-dimethylethyl phenylmethyl ester |
| Benzyl tert-butyl 6-(hydroxymethyl)-1,4-diazepane-1,4-dicarboxylate |
| Benzyl 2-methyl-2-propanyl 6-(hydroxymethyl)-1,4-diazepane-1,4-dicarboxylate |
| 4-O-benzyl 1-O-tert-butyl 6-(hydroxymethyl)-1,4-diazepane-1,4-dicarboxylate |