butyl prop-2-enoate,3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate,styrene
Modify Date: 2025-08-27 11:47:31
butyl prop-2-enoate,3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate,styrene structure
|
Common Name | butyl prop-2-enoate,3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate,styrene | ||
|---|---|---|---|---|
| CAS Number | 110512-92-0 | Molecular Weight | 458.58700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H38O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butyl prop-2-enoate,3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H38O6 |
|---|---|
| Molecular Weight | 458.58700 |
| Exact Mass | 458.26700 |
| PSA | 78.90000 |
| LogP | 5.84890 |
| InChIKey | NSHUPNAUVFCOOB-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCC(C)OC(=O)C(=C)C.C=CC(=O)OCCCC.C=Cc1ccccc1 |
| 2-Propenoic acid,2-methyl-,1-methyl-1,3-propanediyl ester,polymer with butyl 2-propenoate and ethenylbenzene |
| 2-Propenoic acid,2-methyl-,1,1'-(1-methyl-1,3-propanediyl) ester,polymer with butyl 2-propenoate and ethenylbenzene |