4-[2-bis(4-hydroxyphenyl)phosphanylethyl-(4-hydroxyphenyl)phosphanyl]phenol
Modify Date: 2025-10-04 18:55:50
![4-[2-bis(4-hydroxyphenyl)phosphanylethyl-(4-hydroxyphenyl)phosphanyl]phenol Structure](https://image.chemsrc.com/caspic/411/110391-34-9.png)
4-[2-bis(4-hydroxyphenyl)phosphanylethyl-(4-hydroxyphenyl)phosphanyl]phenol structure
|
Common Name | 4-[2-bis(4-hydroxyphenyl)phosphanylethyl-(4-hydroxyphenyl)phosphanyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 110391-34-9 | Molecular Weight | 462.41400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24O4P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-bis(4-hydroxyphenyl)phosphanylethyl-(4-hydroxyphenyl)phosphanyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H24O4P2 |
|---|---|
| Molecular Weight | 462.41400 |
| Exact Mass | 462.11500 |
| PSA | 108.10000 |
| LogP | 4.07460 |
| InChIKey | PDAOPVPKLYAFEV-UHFFFAOYSA-N |
| SMILES | Oc1ccc(P(CCP(c2ccc(O)cc2)c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
|
~10%
4-[2-bis(4-hydr... CAS#:110391-34-9 |
| Literature: Mirabelli; Hill; Faucette; McCabe; Girard; Bryan; Sutton; O'Leary Bartus; Crooke; Johnson Journal of Medicinal Chemistry, 1987 , vol. 30, # 12 p. 2181 - 2190 |
|
~%
4-[2-bis(4-hydr... CAS#:110391-34-9 |
| Literature: Mirabelli; Hill; Faucette; McCabe; Girard; Bryan; Sutton; O'Leary Bartus; Crooke; Johnson Journal of Medicinal Chemistry, 1987 , vol. 30, # 12 p. 2181 - 2190 |
![(4-methoxyphenyl)-[2-(4-methoxyphenyl)phosphanylethyl]phosphane structure](https://image.chemsrc.com/caspic/303/98815-23-7.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2-bis<bis(4-hydroxyphenyl)phosphino>ethane |
| Phenol,4,4',4'',4'''-(1,2-ethanediyldiphosphinidyne)tetrakis |