2-hydroxy-6-iodo-6-methyl-3-propan-2-ylcyclohex-2-en-1-one
Modify Date: 2025-09-21 02:20:55
2-hydroxy-6-iodo-6-methyl-3-propan-2-ylcyclohex-2-en-1-one structure
|
Common Name | 2-hydroxy-6-iodo-6-methyl-3-propan-2-ylcyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 110364-40-4 | Molecular Weight | 294.12900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-6-iodo-6-methyl-3-propan-2-ylcyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15IO2 |
|---|---|
| Molecular Weight | 294.12900 |
| Exact Mass | 294.01200 |
| PSA | 37.30000 |
| LogP | 3.01110 |
| InChIKey | FDTHIYVWIMXSOF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(O)C(=O)C(C)(I)CC1 |
|
~83%
2-hydroxy-6-iod... CAS#:110364-40-4 |
| Literature: Horiuchi; Suzuki Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 9 p. 2919 - 2922 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Cyclohexen-1-one,2-hydroxy-6-iodo-6-methyl-3-(1-methylethyl) |
| 3-iodo-3-methyl-6-isopropyl-1,2-cyclohexanedione |