[(4-methoxybenzoyl)oxy-bis(4-phenylphenyl)stannyl] 4-methoxybenzoate structure
|
Common Name | [(4-methoxybenzoyl)oxy-bis(4-phenylphenyl)stannyl] 4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 110301-88-7 | Molecular Weight | 727.37900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H32O6Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(4-methoxybenzoyl)oxy-bis(4-phenylphenyl)stannyl] 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C40H32O6Sn |
|---|---|
| Molecular Weight | 727.37900 |
| Exact Mass | 728.12200 |
| PSA | 98.72000 |
| LogP | 5.73500 |
| InChIKey | FYCTYVUMUJCISS-UHFFFAOYSA-L |
| SMILES | COc1ccc(C(=O)O[Sn](OC(=O)c2ccc(OC)cc2)(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
|
~%
[(4-methoxybenz... CAS#:110301-88-7 |
| Literature: Trehan, J. C.; Sharma, R. K.; Kumar, N.; Sharma, C. P. Journal of the Indian Chemical Society, 1986 , vol. 63, p. 371 - 373 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Stannane,bis([1,1'-biphenyl]-4-yl)bis[(4-methoxybenzoyl)oxy] |
| bis-anisylcarboxylatobis(p-biphenyl)tin(IV) |