phenacyl 4-methoxybenzenesulfonate
Modify Date: 2025-10-12 17:27:38
phenacyl 4-methoxybenzenesulfonate structure
|
Common Name | phenacyl 4-methoxybenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 110143-18-5 | Molecular Weight | 306.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenacyl 4-methoxybenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O5S |
|---|---|
| Molecular Weight | 306.33400 |
| Exact Mass | 306.05600 |
| PSA | 78.05000 |
| LogP | 3.36420 |
| InChIKey | CEXKSGAYTWIDDT-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)OCC(=O)c2ccccc2)cc1 |
|
~%
phenacyl 4-meth... CAS#:110143-18-5 |
| Literature: Yousaf, T. I.; Lewis, E. S. Journal of the American Chemical Society, 1987 , vol. 109, # 20 p. 6137 - 6142 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenesulfonic acid,4-methoxy-,2-oxo-2-phenylethyl ester |