TOSAGESTIN
Modify Date: 2024-01-09 22:30:12
TOSAGESTIN structure
|
Common Name | TOSAGESTIN | ||
|---|---|---|---|---|
| CAS Number | 110072-15-6 | Molecular Weight | 308.41400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TOSAGESTINTosagestin(Org 30659) is a 19-nortestosterone–derived progestagen. Tosagestinsuppresses ovarian function to a level sufficient to inhibit ovulation. Tosagestininhibits cell growth in T47D-S cells[1][2]. |
| Name | (17alpha)-17-hydroxy-11-methylene-19-norpregna-4,15-diene-20-yn-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Tosagestin(Org 30659) is a 19-nortestosterone–derived progestagen. Tosagestinsuppresses ovarian function to a level sufficient to inhibit ovulation. Tosagestininhibits cell growth in T47D-S cells[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H24O2 |
|---|---|
| Molecular Weight | 308.41400 |
| Exact Mass | 308.17800 |
| PSA | 37.30000 |
| LogP | 3.43460 |
| InChIKey | YJSTYQGZKJHXLN-OLGWUGKESA-N |
| SMILES | C#CC1(O)C=CC2C3CCC4=CC(=O)CCC4C3C(=C)CC21C |
| (17α)-17-hydroxy-11-methylene-19-norpregna-4,15-diene-20-yn-3-one |
| (8R,9S,10R,13S,14S,17R)-17-Ethynyl-17-hydroxy-13-methyl-11-methylene-1,2,6,7,8,9,10,11,12,13,14,17-dodecahydro-cyclopenta[a]phenanthren-3-one |
| [3H]-Tosagestin |
| 17β-hydroxy-11-methylene-19-nor-17α-pregna-4,15-dien-20-yn-3-one |
| Tosagestin |
| 11-methylene-17α-ethinyl-17β-hydroxy-oestra-4,15-dien-3-one |
| (17α)-17-hydroxy-11-methylene-19-norpregna-4, 15-dien-20-yn-3-one |