4-[1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol structure
|
Common Name | 4-[1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 110047-22-8 | Molecular Weight | 282.37700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H22O2 |
|---|---|
| Molecular Weight | 282.37700 |
| Exact Mass | 282.16200 |
| PSA | 40.46000 |
| LogP | 4.59400 |
| InChIKey | GYLZMVYMSPSPDA-UHFFFAOYSA-N |
| SMILES | CC1CCCC(c2ccc(O)cc2)(c2ccc(O)cc2)C1 |
|
~%
4-[1-(4-hydroxy... CAS#:110047-22-8 |
| Literature: Journal of the American Chemical Society, , vol. 61, p. 345 |
|
~%
4-[1-(4-hydroxy... CAS#:110047-22-8 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 472, p. 34 |
|
~%
4-[1-(4-hydroxy... CAS#:110047-22-8 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 472, p. 34 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| T0509-6987 |
| 1,1-bis-(4-hydroxy-phenyl)-3-methyl-cyclohexane |
| Phenol,4,4'-(3-methylcyclohexylidene)bis |