4-[[4-(dimethylamino)phenyl]-phenylphosphanyl]-N,N-dimethylaniline
Modify Date: 2025-08-25 17:38:09
![4-[[4-(dimethylamino)phenyl]-phenylphosphanyl]-N,N-dimethylaniline Structure](https://image.chemsrc.com/caspic/444/1100-11-4.png)
4-[[4-(dimethylamino)phenyl]-phenylphosphanyl]-N,N-dimethylaniline structure
|
Common Name | 4-[[4-(dimethylamino)phenyl]-phenylphosphanyl]-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 1100-11-4 | Molecular Weight | 348.42100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H25N2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[[4-(dimethylamino)phenyl]-phenylphosphanyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H25N2P |
|---|---|
| Molecular Weight | 348.42100 |
| Exact Mass | 348.17600 |
| PSA | 20.07000 |
| LogP | 3.57680 |
| InChIKey | PSVLQPNUBVIRPF-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(P(c2ccccc2)c2ccc(N(C)C)cc2)cc1 |
| HS Code | 2921590090 |
|---|
|
~73%
4-[[4-(dimethyl... CAS#:1100-11-4 |
| Literature: Doorn, Johannes A. van; Frijns, John H. G.; Meijboom, Nico Recueil des Travaux Chimiques des Pays-Bas, 1991 , vol. 110, # 11 p. 441 - 449 |
|
~%
4-[[4-(dimethyl... CAS#:1100-11-4 |
| Literature: Horner, L.; Simons, G. Phosphorus and Sulfur and the Related Elements, 1983 , vol. 15, p. 165 - 176 |
![[p-(dimethylamino)phenyl]lithium structure](https://image.chemsrc.com/caspic/199/13190-50-6.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-[(4-dimethylaminophenyl)-phenylphosphanyl]-N,N-dimethylaniline |
| bis-(dimethylaminophenyl)-phenylphosphine |
| Bis-(4-dimethylaminophenyl)-phenyl-phosphin |
| Benzenamine,4,4'-(phenylphosphinidene)bis[N,N-dimethyl |
| bis<4-(dimethylamino)phenyl>phenylphosphine |
| bis(p-dimethylaminophenyl)phenylphosphine |
| bis(p-N,N-dimethylaminophenyl)phenylphosphane |
| tetra-N-methyl-4,4'-phenylphosphanediyl-bis-aniline |
| 4,4'-(phenylphosphanediyl)bis(N,N-dimethylaniline) |