2-[4-[(2,4-dichlorobenzoyl)amino]-3-hydroxyphenyl]propanoic acid
Modify Date: 2025-08-24 16:59:54
![2-[4-[(2,4-dichlorobenzoyl)amino]-3-hydroxyphenyl]propanoic acid Structure](https://image.chemsrc.com/caspic/024/109790-34-3.png)
2-[4-[(2,4-dichlorobenzoyl)amino]-3-hydroxyphenyl]propanoic acid structure
|
Common Name | 2-[4-[(2,4-dichlorobenzoyl)amino]-3-hydroxyphenyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 109790-34-3 | Molecular Weight | 354.18500 | |
| Density | 1.505g/cm3 | Boiling Point | 478.5ºC at 760mmHg | |
| Molecular Formula | C16H13Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.2ºC | |
| Name | 2-[4-[(2,4-dichlorobenzoyl)amino]-3-hydroxyphenyl]propanoic acid |
|---|
| Density | 1.505g/cm3 |
|---|---|
| Boiling Point | 478.5ºC at 760mmHg |
| Molecular Formula | C16H13Cl2NO4 |
| Molecular Weight | 354.18500 |
| Flash Point | 243.2ºC |
| Exact Mass | 353.02200 |
| PSA | 90.12000 |
| LogP | 4.52340 |
| Vapour Pressure | 5.77E-10mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | GXDLOYKGCALKRZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)c(O)c1 |
|
~87%
2-[4-[(2,4-dich... CAS#:109790-34-3 |
| Literature: Chakrabarti; Hicks European Journal of Medicinal Chemistry, 1987 , vol. 22, # 2 p. 161 - 163 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |