2,4-difluoro-N-(2-hydroxyphenyl)benzamide structure
|
Common Name | 2,4-difluoro-N-(2-hydroxyphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 109790-33-2 | Molecular Weight | 249.21300 | |
| Density | 1.422g/cm3 | Boiling Point | 292.5ºC at 760 mmHg | |
| Molecular Formula | C13H9F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.7ºC | |
| Name | 2,4-difluoro-N-(2-hydroxyphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 292.5ºC at 760 mmHg |
| Molecular Formula | C13H9F2NO2 |
| Molecular Weight | 249.21300 |
| Flash Point | 130.7ºC |
| Exact Mass | 249.06000 |
| PSA | 52.82000 |
| LogP | 3.30670 |
| Vapour Pressure | 0.00105mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | MKZZFGGBGQVIFR-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1O)c1ccc(F)cc1F |
|
~76%
2,4-difluoro-N-... CAS#:109790-33-2 |
| Literature: Chakrabarti; Hicks European Journal of Medicinal Chemistry, 1987 , vol. 22, # 2 p. 161 - 163 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzamide,2,4-difluoro-N-(2-hydroxyphenyl) |