Utibapril structure
|
Common Name | Utibapril | ||
|---|---|---|---|---|
| CAS Number | 109683-61-6 | Molecular Weight | 449.56400 | |
| Density | 1.24g/cm3 | Boiling Point | 597.5ºC at 760 mmHg | |
| Molecular Formula | C22H31N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.2ºC | |
Use of UtibaprilUtibapril is an angiotensin-converting enzyme (ACE) inhibitor with antihypertensive activities. |
| Name | 5-tert-butyl-3-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2H-1,3,4-thiadiazole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Utibapril is an angiotensin-converting enzyme (ACE) inhibitor with antihypertensive activities. |
|---|---|
| Related Catalog | |
| In Vivo | Utibapril significantly inhibits plasma, renal, and vascular ACE but not ventricular ACE activity. Utibapril (2 μg/kg/day) significantly inhibits vascular ACE activity, and Utibapril (250 μg/kg/day) results in a significant inhibition of plasma ACE. Furthermore, angiotensin I-induced decreases in coronary flow in the isolated heart are significantly inhibited after treatment with the higher doses of utibapril[1]. FPL 63547 is rapidly and extensively excreted as the diacid in the bile but appeared in the urine in negligible amounts[2]. |
| References |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 597.5ºC at 760 mmHg |
| Molecular Formula | C22H31N3O5S |
| Molecular Weight | 449.56400 |
| Flash Point | 315.2ºC |
| Exact Mass | 449.19800 |
| PSA | 133.60000 |
| LogP | 2.63910 |
| Vapour Pressure | 3.98E-15mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | FTYVYAGWBXTWTN-ZVZYQTTQSA-N |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1N=C(C(C)(C)C)SC1C(=O)O |
| Storage condition | 2-8℃ |
| Utibaprilo |
| Utibaprilo [INN-Spanish] |
| 5-tert-butyl-3-[n-(1-ethoxy-1-oxo-4-phenylbutan-2-yl)alanyl]-2,3-dihydro-1,3,4-thiadiazole-2-carboxylic acid |
| Utibapril |
| Utibaprilum [INN-Latin] |
| Utibaprilum |
| 5-tert-butyl-3-{N-[1(S)-(ethoxycarbonyl)-3-phenylpropyl]-L-alanyl}-2,3-dihydro-1,3,4-thiadiazole-2(S)-carboxylic acid |