N-(2-aminoethyl)-2-tritylsulfanylacetamide
Modify Date: 2025-09-17 08:35:42
N-(2-aminoethyl)-2-tritylsulfanylacetamide structure
|
Common Name | N-(2-aminoethyl)-2-tritylsulfanylacetamide | ||
|---|---|---|---|---|
| CAS Number | 109545-74-6 | Molecular Weight | 376.51400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-aminoethyl)-2-tritylsulfanylacetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H24N2OS |
|---|---|
| Molecular Weight | 376.51400 |
| Exact Mass | 376.16100 |
| PSA | 83.91000 |
| LogP | 5.32720 |
| InChIKey | VCKUKSMPKHFWJT-UHFFFAOYSA-N |
| SMILES | NCCNC(=O)CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~%
N-(2-aminoethyl... CAS#:109545-74-6 |
| Literature: President and Fellows of Harvard College Patent: US2012/269724 A1, 2012 ; |
|
~52%
N-(2-aminoethyl... CAS#:109545-74-6 |
| Literature: Abram, Ulrich; Abram, Sonja; Hiller, Wolfgang; Morgan, Gillian F.; Thornback, John R.; et al. Zeitschrift fuer Naturforschung, B: Chemical Sciences, 1991 , vol. 46, # 4 p. 453 - 458 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(2-aminoethyl)-2-(S-tritylmercapto)acetamide |
| N-(2-aminoethyl)-2-(triphenylmethylthio)acetamide |
| Acetamide,N-(2-aminoethyl)-2-[(triphenylmethyl)thio] |