Glycine, N,N-dimethyl-, I(2)-ester with chloramphenicol
Modify Date: 2025-10-23 20:45:32
Glycine, N,N-dimethyl-, I(2)-ester with chloramphenicol structure
|
Common Name | Glycine, N,N-dimethyl-, I(2)-ester with chloramphenicol | ||
|---|---|---|---|---|
| CAS Number | 109476-41-7 | Molecular Weight | 408.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19Cl2N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Glycine, N,N-dimethyl-, I(2)-ester with chloramphenicol |
|---|
| Molecular Formula | C15H19Cl2N3O6 |
|---|---|
| Molecular Weight | 408.2 |
| InChIKey | IIYPZCYVXGPZBO-DGCLKSJQSA-N |
| SMILES | CN(C)CC(=O)OC(c1ccc([N+](=O)[O-])cc1)C(CO)NC(=O)C(Cl)Cl |