Zolpidem Phenyl-4-carboxylic Acid
Modify Date: 2025-08-26 19:16:43
Zolpidem Phenyl-4-carboxylic Acid structure
|
Common Name | Zolpidem Phenyl-4-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 109461-65-6 | Molecular Weight | 429.51100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H27N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 55.4 °F | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | 4-[3-[2-(dimethylamino)-2-oxoethyl]-6-methylimidazo[1,2-a]pyridin-2-yl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H27N3O3 |
|---|---|
| Molecular Weight | 429.51100 |
| Exact Mass | 429.20500 |
| PSA | 74.91000 |
| LogP | 4.63360 |
| InChIKey | FELZONDEFBLTSP-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(-c3ccc(C(=O)O)cc3)c(CC(=O)N(C)C)n2c1 |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302-H319 |
| Precautionary Statements | P210-P305 + P351 + P338 |
| RIDADR | UN 1648 3 / PGII |
| Flash Point(F) | 55.4 °F |
| Flash Point(C) | 13 °C |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
A simple and rapid method for the identification of zolpidem carboxylic acid in urine.
J. Anal. Toxicol. 31(4) , 195-9, (2007) Zolpidem is a non-benzodiazepine hypnotic that has been implicated in both drug-facilitated sexual assault and drink spiking. Detection of the drug in urine is extremely difficult because of its exten... |
| Zolpidem Carboxylic Acid |
| Imidazo[1,2-a]pyridine,benzoic acid deriv. |
| SL 84.0589 |
| 4-[(3-dimethylcarbamoylmethyl-6-methyl)imidazo[1,2-a]pyridin-2-yl]benzoic acid |
| Zolpidem Phenyl-4-carboxylic Acid |
| UNII-OGV9R9660K |
| Benzoic acid,4-(3-(2-(dimethylamino)-2-oxoethyl)-6-methylimidazo(1,2-a)pyridin-2-yl) |