trimethyl-[5-(5-trimethylammoniopentoxy)pentyl]azanium diiodide structure
|
Common Name | trimethyl-[5-(5-trimethylammoniopentoxy)pentyl]azanium diiodide | ||
|---|---|---|---|---|
| CAS Number | 109448-61-5 | Molecular Weight | 528.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H38I2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[5-[5-(trimethylazaniumyl)pentoxy]pentyl]azanium,diiodide |
|---|
| Molecular Formula | C16H38I2N2O |
|---|---|
| Molecular Weight | 528.29500 |
| Exact Mass | 528.10700 |
| PSA | 9.23000 |
| InChIKey | CJCHXUPJGGBJMH-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCCCCOCCCCC[N+](C)(C)C.[I-].[I-] |
|
~%
trimethyl-[5-(5... CAS#:109448-61-5 |
| Literature: Journal of Scientific and Industrial Research, , vol. 15C, p. 177,180 |
|
~%
trimethyl-[5-(5... CAS#:109448-61-5 |
|
Literature: J.Pharm.Belg. |
|
~%
trimethyl-[5-(5... CAS#:109448-61-5 |
| Literature: Journal of Scientific and Industrial Research, , vol. 15C, p. 177,180 |