Ezetimibe D4
Modify Date: 2025-08-20 19:41:06
Ezetimibe D4 structure
|
Common Name | Ezetimibe D4 | ||
|---|---|---|---|---|
| CAS Number | 1093659-90-5 | Molecular Weight | 413.450 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 654.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H17D4F2NO3 | Melting Point | 152-154°C | |
| MSDS | N/A | Flash Point | 349.9±31.5 °C | |
Use of Ezetimibe D4Ezetimibe D4 (SCH 58235 D4) is the deuterium labeled Ezetimibe. Ezetimibe is a Niemann-Pick C1-like1 (NPC1L1) inhibitor, and is a potent Nrf2 activator. |
| Name | Ezetimibe-d4 |
|---|---|
| Synonym | More Synonyms |
| Description | Ezetimibe D4 (SCH 58235 D4) is the deuterium labeled Ezetimibe. Ezetimibe is a Niemann-Pick C1-like1 (NPC1L1) inhibitor, and is a potent Nrf2 activator. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 654.9±55.0 °C at 760 mmHg |
| Melting Point | 152-154°C |
| Molecular Formula | C24H17D4F2NO3 |
| Molecular Weight | 413.450 |
| Flash Point | 349.9±31.5 °C |
| Exact Mass | 413.174042 |
| PSA | 60.77000 |
| LogP | 3.26 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | OLNTVTPDXPETLC-ARVCERDTSA-N |
| SMILES | O=C1C(CCC(O)c2ccc(F)cc2)C(c2ccc(O)cc2)N1c1ccc(F)cc1 |
| Storage condition | 2-8℃ |
| Ezetimibe d4 |
| (3R,4S)-1-[4-Fluoro(H)phenyl]-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)-2-azetidinone |
| Zetia D4 |
| (3R,4S)-1-(4-Fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)-2-azetidinone-d4 |
| 2-Azetidinone, 1-(4-fluorophenyl-2,3,5,6-d)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)-, (3R,4S)- |