4-tert-butyl-2-[(cyclohexylamino)methyl]phenol
Modify Date: 2025-09-26 14:12:30
![4-tert-butyl-2-[(cyclohexylamino)methyl]phenol Structure](https://image.chemsrc.com/caspic/237/109252-85-9.png)
4-tert-butyl-2-[(cyclohexylamino)methyl]phenol structure
|
Common Name | 4-tert-butyl-2-[(cyclohexylamino)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 109252-85-9 | Molecular Weight | 261.40200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H27NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-2-[(cyclohexylamino)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H27NO |
|---|---|
| Molecular Weight | 261.40200 |
| Exact Mass | 261.20900 |
| PSA | 32.26000 |
| LogP | 4.50290 |
| InChIKey | JTVHIQJYLQMKRA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(O)c(CNC2CCCCC2)c1 |
|
~%
4-tert-butyl-2-... CAS#:109252-85-9 |
| Literature: Burke Journal of the American Chemical Society, 1949 , vol. 71, p. 609,610 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phenol,2-[(cyclohexylamino)methyl]-4-(1,1-dimethylethyl) |
| GNF-Pf-5310 |
| 4-tert-Butyl-2-cyclohexylaminomethyl-phenol |
| 2-cyclohexylaminomethyl-4-tertbutylphenol |
| 2-cyclohexylamino-methyl-4-t-butylphenol |