camellianin B
Modify Date: 2025-08-26 03:39:40
camellianin B structure
|
Common Name | camellianin B | ||
|---|---|---|---|---|
| CAS Number | 109232-76-0 | Molecular Weight | 578.51900 | |
| Density | 1.69g/cm3 | Boiling Point | 937.4ºC at 760mmHg | |
| Molecular Formula | C27H30O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.4ºC | |
Use of camellianin BCamellianin B, a flavonoid compound, is a Camellianin A metabolite. Camellianin B has antioxidant and angiotensin converting enzyme (ACE) inhibitory activities[1][2]. |
| Name | 5-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-7-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Camellianin B, a flavonoid compound, is a Camellianin A metabolite. Camellianin B has antioxidant and angiotensin converting enzyme (ACE) inhibitory activities[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | At 500 μg/mL, the ACE inhibitory activities of Camellianin B is 40.68%. Camellianin B has DPPH radical scavenging activity with IC50 value of 1.8 mg/mL[2]. |
| In Vivo | Camellianin B has a wide tissue distribution with brain penetration[1]. |
| References |
| Density | 1.69g/cm3 |
|---|---|
| Boiling Point | 937.4ºC at 760mmHg |
| Molecular Formula | C27H30O14 |
| Molecular Weight | 578.51900 |
| Flash Point | 312.4ºC |
| Exact Mass | 578.16400 |
| PSA | 228.97000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.726 |
| InChIKey | LRFDUPNLCDXZOE-ZLDQKHMLSA-N |
| SMILES | CC1OC(OC2C(CO)OC(Oc3cc(O)cc4oc(-c5ccc(O)cc5)cc(=O)c34)C(O)C2O)C(O)C(O)C1O |
| Camellianin B |