4-(6,7,8,9-TETRAHYDRO-5H-[1,2,4]TRIAZOLO[4,3-A]AZEPIN-3-YL)-PHENYLAMINE structure
|
Common Name | 4-(6,7,8,9-TETRAHYDRO-5H-[1,2,4]TRIAZOLO[4,3-A]AZEPIN-3-YL)-PHENYLAMINE | ||
|---|---|---|---|---|
| CAS Number | 109220-81-7 | Molecular Weight | 228.29300 | |
| Density | 1.31g/cm3 | Boiling Point | 474.2ºC at 760mmHg | |
| Molecular Formula | C13H16N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.6ºC | |
| Name | 4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 474.2ºC at 760mmHg |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.29300 |
| Flash Point | 240.6ºC |
| Exact Mass | 228.13700 |
| PSA | 56.73000 |
| LogP | 2.83490 |
| Vapour Pressure | 3.7E-09mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | IDZQVFCQHCCFCF-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2nnc3n2CCCCC3)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-<4-Amino-phenyl>-4.5-pentamethylen-1.2.4-triazol |
| 4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-aniline |
| Benzenamine,4-(6,7,8,9-tetrahydro-5H-1,2,4-triazolo[4,3-a]azepin-3-yl) |
| 4-(6,7,8,9-Tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-phenylamine |