2,3-dimethyl-6-nitrobenzaldehyde
Modify Date: 2025-12-05 11:21:44
2,3-dimethyl-6-nitrobenzaldehyde structure
|
Common Name | 2,3-dimethyl-6-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 109133-82-6 | Molecular Weight | 179.17300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-dimethyl-6-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9NO3 |
|---|---|
| Molecular Weight | 179.17300 |
| Exact Mass | 179.05800 |
| PSA | 62.89000 |
| LogP | 2.54730 |
| InChIKey | AGIWNONRDJEVHH-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(C=O)c1C |
|
~90%
2,3-dimethyl-6-... CAS#:109133-82-6 |
| Literature: Bristol-Myers Company Patent: US4668686 A1, 1987 ; |
|
~%
2,3-dimethyl-6-... CAS#:109133-82-6 |
| Literature: Meanwell; Roth; Smith; Wedding; Wright; Fleming; Gillespie Journal of Medicinal Chemistry, 1991 , vol. 34, # 9 p. 2906 - 2916 |
|
~%
2,3-dimethyl-6-... CAS#:109133-82-6 |
| Literature: Meanwell; Roth; Smith; Wedding; Wright; Fleming; Gillespie Journal of Medicinal Chemistry, 1991 , vol. 34, # 9 p. 2906 - 2916 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![5-[(2,3-dimethyl-6-nitrophenyl)methylidene]imidazolidine-2,4-dione structure](https://image.chemsrc.com/caspic/139/109133-81-5.png)
CAS#:109133-81-5| Benzaldehyde,2,3-dimethyl-6-nitro |