6-methylheptyl prop-2-enoate,prop-2-enamide,styrene
Modify Date: 2025-11-27 13:04:37
6-methylheptyl prop-2-enoate,prop-2-enamide,styrene structure
|
Common Name | 6-methylheptyl prop-2-enoate,prop-2-enamide,styrene | ||
|---|---|---|---|---|
| CAS Number | 109075-75-4 | Molecular Weight | 359.50200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H33NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methylheptyl prop-2-enoate,prop-2-enamide,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H33NO3 |
|---|---|
| Molecular Weight | 359.50200 |
| Exact Mass | 359.24600 |
| PSA | 70.38000 |
| LogP | 6.06900 |
| InChIKey | WMIJEWJJDNHONO-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCCCCC(C)C.C=CC(N)=O.C=Cc1ccccc1 |
| 2-Propenoic acid,isooctyl ester,polymer with ethenylbenzene and 2-propenamide |