[2,2-dimethyl-3-oxo-3-[2-(trimethylazaniumyl)ethoxy]propyl]-trimethylazanium,diiodide structure
|
Common Name | [2,2-dimethyl-3-oxo-3-[2-(trimethylazaniumyl)ethoxy]propyl]-trimethylazanium,diiodide | ||
|---|---|---|---|---|
| CAS Number | 109042-63-9 | Molecular Weight | 500.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H30I2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2,2-dimethyl-3-oxo-3-[2-(trimethylazaniumyl)ethoxy]propyl]-trimethylazanium,diiodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H30I2N2O2 |
|---|---|
| Molecular Weight | 500.19800 |
| Exact Mass | 500.04000 |
| PSA | 26.30000 |
| InChIKey | AQMJRRJYEWFFGT-UHFFFAOYSA-L |
| SMILES | CC(C)(C[N+](C)(C)C)C(=O)OCC[N+](C)(C)C.[I-].[I-] |
|
~%
[2,2-dimethyl-3... CAS#:109042-63-9 |
| Literature: Halverstadt et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3618,3620 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2-Carboxy-2-methylpropyl)trimethylammonium iodide ester with choline iodide |
| [2,2-dimethyl-3-oxo-3-[2-(trimethylazaniumyl)ethoxy]propyl]-trimethylazanium diiodide |
| 2,2-Dimethyl-3-trimethylammonio-propionsaeure-(2-trimethylammonio-aethylester),Dijodid |
| 2-Trimethylammonioethyl 2,2-dimethyl-3-trimethylammoniopropionate diiodide |
| Ammonium,(2-carboxy-2-methylpropyl)trimethyl-,iodide,ester with choline iodide |
| 2,2-dimethyl-3-trimethylammonio-propionic acid-(2-trimethylammonio-ethyl ester),diiodide |