2-(4-benzhydrylpiperazin-1-yl)ethanol,dihydrochloride
Modify Date: 2025-08-27 14:32:42
2-(4-benzhydrylpiperazin-1-yl)ethanol,dihydrochloride structure
|
Common Name | 2-(4-benzhydrylpiperazin-1-yl)ethanol,dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 108983-83-1 | Molecular Weight | 369.328 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-benzhydrylpiperazin-1-yl)ethanol,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H26Cl2N2O |
|---|---|
| Molecular Weight | 369.328 |
| Exact Mass | 368.142212 |
| PSA | 26.71000 |
| LogP | 3.86570 |
| InChIKey | DJRDCMNGICGKGJ-UHFFFAOYSA-N |
| SMILES | Cl.Cl.OCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| AC-5327 |
| 4-benzhydryl-1-piperazineethanol dihydrochloride |
| 2-[4-(Diphenylmethyl)piperazin-1-yl]ethanol dihydrochloride |
| 2-[4-(Diphenylmethyl)-1-piperazinyl]ethanol dihydrochloride |
| 1-Piperazineethanol, 4-(diphenylmethyl)-, hydrochloride (1:2) |