ACS67
Modify Date: 2025-09-13 18:04:57
ACS67 structure
|
Common Name | ACS67 | ||
|---|---|---|---|---|
| CAS Number | 1088434-86-9 | Molecular Weight | 598.836 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 777.4±70.0 °C at 760 mmHg | |
| Molecular Formula | C32H38O5S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 424.0±35.7 °C | |
Use of ACS67ACS67 is an F-series prostaglandin (PG) analog for treatment of glaucoma. ACS 67 reduces intra-ocular pressure (IOP) and increases levels of reduced glutathione and cGMP in the aqueous humor of glaucomatous pigmented rabbits. ACS67 also acts as a neuroprotectant that stimulates GSH levels. |
| Name | acs 67 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 777.4±70.0 °C at 760 mmHg |
| Molecular Formula | C32H38O5S3 |
| Molecular Weight | 598.836 |
| Flash Point | 424.0±35.7 °C |
| Exact Mass | 598.188110 |
| PSA | 175.56000 |
| LogP | 5.48 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | JEEWZRQQYWVJCX-WEWVERJPSA-N |
| SMILES | O=C(CCCC=CCC1C(O)CC(O)C1CCC(O)CCc1ccccc1)Oc1ccc(-c2cc(=S)ss2)cc1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(3-Thioxo-3H-1,2-dithiol-5-yl)phenyl (5Z)-7-[3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]-5-heptenoate |
| 5-Heptenoic acid, 7-[3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]-, 4-(3-thioxo-3H-1,2-dithiol-5-yl)phenyl ester, (5Z)- |
| 5-p-nitrobenzylidene-2-thiohydantoin |