4-Methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid structure
|
Common Name | 4-Methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1086398-97-1 | Molecular Weight | 176.172 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.172 |
| Exact Mass | 176.058578 |
| PSA | 65.98000 |
| LogP | 2.45 |
| Index of Refraction | 1.709 |
| InChIKey | ZHBZQRBKHWECFT-UHFFFAOYSA-N |
| SMILES | Cc1ccnc2[nH]c(C(=O)O)cc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Methyl-7-azaindole-2-carboxylic acid |
| 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 4-methyl- |
| 4-Methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |