2-[2-(1,3-benzodithiol-2-ylidene)-1,2-dibromoethylidene]-1,3-benzodithiole
Modify Date: 2025-12-12 19:25:37
![2-[2-(1,3-benzodithiol-2-ylidene)-1,2-dibromoethylidene]-1,3-benzodithiole Structure](https://image.chemsrc.com/caspic/433/108591-96-4.png)
2-[2-(1,3-benzodithiol-2-ylidene)-1,2-dibromoethylidene]-1,3-benzodithiole structure
|
Common Name | 2-[2-(1,3-benzodithiol-2-ylidene)-1,2-dibromoethylidene]-1,3-benzodithiole | ||
|---|---|---|---|---|
| CAS Number | 108591-96-4 | Molecular Weight | 488.30300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H8Br2S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(1,3-benzodithiol-2-ylidene)-1,2-dibromoethylidene]-1,3-benzodithiole |
|---|
| Molecular Formula | C16H8Br2S4 |
|---|---|
| Molecular Weight | 488.30300 |
| Exact Mass | 485.78800 |
| PSA | 101.20000 |
| LogP | 7.91040 |
| InChIKey | IOQBPVHBVCKGEF-UHFFFAOYSA-N |
| SMILES | BrC(=C1Sc2ccccc2S1)C(Br)=C1Sc2ccccc2S1 |
|
~%
2-[2-(1,3-benzo... CAS#:108591-96-4 |
| Literature: Sugimoto,T.; Misaki,Y.; Kajita,T. Journal of the American Chemical Society, 1987 , vol. 109, p. 4106 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |