2-Amino-4-(4-isopropylphenyl)thiazole structure
|
Common Name | 2-Amino-4-(4-isopropylphenyl)thiazole | ||
|---|---|---|---|---|
| CAS Number | 108481-92-1 | Molecular Weight | 218.31800 | |
| Density | 1.15g/cm3 | Boiling Point | 374ºC at 760mmHg | |
| Molecular Formula | C12H14N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180ºC | |
| Name | 2-Amino-4-(4-isopropylphenyl)thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 374ºC at 760mmHg |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.31800 |
| Flash Point | 180ºC |
| Exact Mass | 218.08800 |
| PSA | 67.15000 |
| LogP | 4.09690 |
| Vapour Pressure | 8.63E-06mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | UFBAQAAATDLTAZ-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(-c2csc(N)n2)cc1 |
| HS Code | 2934100090 |
|---|
|
~%
2-Amino-4-(4-is... CAS#:108481-92-1 |
| Literature: WO2005/103022 A1, ; Page/Page column 92; 97 ; WO 2005/103022 A1 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine |
| 4-(4-ISOPROPYL-PHENYL)-THIAZOL-2-YLAMINE |