5-[3-(2-hydroxy-1,3,4,5-tetramethylcyclopent-3-en-1-yl)propyl]-2,3,4,5-tetramethylcyclopent-2-en-1-ol structure
|
Common Name | 5-[3-(2-hydroxy-1,3,4,5-tetramethylcyclopent-3-en-1-yl)propyl]-2,3,4,5-tetramethylcyclopent-2-en-1-ol | ||
|---|---|---|---|---|
| CAS Number | 108344-73-6 | Molecular Weight | 320.50900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H36O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[3-(2-hydroxy-1,3,4,5-tetramethylcyclopent-3-en-1-yl)propyl]-2,3,4,5-tetramethylcyclopent-2-en-1-ol |
|---|
| Molecular Formula | C21H36O2 |
|---|---|
| Molecular Weight | 320.50900 |
| Exact Mass | 320.27200 |
| PSA | 40.46000 |
| LogP | 4.86330 |
| InChIKey | UJQGTVGUPZDHQW-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C(O)C(C)(CCCC2(C)C(C)C(C)=C(C)C2O)C1C |
|
~%
5-[3-(2-hydroxy... CAS#:108344-73-6 |
| Literature: Mintz, Eric A.; Pando, Jerome C.; Zervos, Irene Journal of Organic Chemistry, 1987 , vol. 52, # 13 p. 2948 - 2950 |
|
~%
5-[3-(2-hydroxy... CAS#:108344-73-6 |
| Literature: Mintz, Eric A.; Pando, Jerome C.; Zervos, Irene Journal of Organic Chemistry, 1987 , vol. 52, # 13 p. 2948 - 2950 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |