Pyrimidine,2-[2-(5-nitro-2-furanyl)ethenyl]- structure
|
Common Name | Pyrimidine,2-[2-(5-nitro-2-furanyl)ethenyl]- | ||
|---|---|---|---|---|
| CAS Number | 1083-59-6 | Molecular Weight | 217.18100 | |
| Density | 1.412g/cm3 | Boiling Point | 270ºC at 760mmHg | |
| Molecular Formula | C10H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.1ºC | |
| Name | 2-[2-(5-nitrofuran-2-yl)ethenyl]pyrimidine |
|---|
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 270ºC at 760mmHg |
| Molecular Formula | C10H7N3O3 |
| Molecular Weight | 217.18100 |
| Flash Point | 117.1ºC |
| Exact Mass | 217.04900 |
| PSA | 84.74000 |
| LogP | 2.67140 |
| Vapour Pressure | 0.0116mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | QYWCIRZOGSMFAW-DUXPYHPUSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2ncccn2)o1 |
|
~%
Pyrimidine,2-[2... CAS#:1083-59-6 |
| Literature: Fujita; Yamamoto; Minami; Takamatsu Chemical and pharmaceutical bulletin, 1965 , vol. 13, # 10 p. 1183 - 1193 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |