Haploside C
Modify Date: 2025-10-01 13:35:54
Haploside C structure
|
Common Name | Haploside C | ||
|---|---|---|---|---|
| CAS Number | 108279-04-5 | Molecular Weight | 696.61 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 963.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C31H36O18 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 307.7±27.8 °C | |
Use of Haploside CDescription Natural product derived from plant source.} |
| Name | Haploside C |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 963.5±65.0 °C at 760 mmHg |
| Molecular Formula | C31H36O18 |
| Molecular Weight | 696.61 |
| Flash Point | 307.7±27.8 °C |
| Exact Mass | 696.190186 |
| LogP | 1.37 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | JGGRFKDDIGORCC-LHYXFQTCSA-N |
| SMILES | COc1cc(-c2oc3c(OC)c(OC4OC(COC(C)=O)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)cc(O)c3c(=O)c2O)ccc1O |
| Water Solubility | DMSO：1mg/mL |
| RIDADR | NONH for all modes of transport |
|---|
| MFCD29037218 |