3,6-di-O-benzoyl-2,4-dideoxyhexopyranose structure
|
Common Name | 3,6-di-O-benzoyl-2,4-dideoxyhexopyranose | ||
|---|---|---|---|---|
| CAS Number | 108274-17-5 | Molecular Weight | 356.36900 | |
| Density | 1.3g/cm3 | Boiling Point | 514.1ºC at 760 mmHg | |
| Molecular Formula | C20H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4ºC | |
| Name | [(2S,4R,6S)-4-benzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 514.1ºC at 760 mmHg |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.36900 |
| Flash Point | 181.4ºC |
| Exact Mass | 356.12600 |
| PSA | 82.06000 |
| LogP | 2.56640 |
| Vapour Pressure | 2.14E-11mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | KJDUPJPADSEGKU-SQNIBIBYSA-N |
| SMILES | O=C(OCC1CC(OC(=O)c2ccccc2)CC(O)O1)c1ccccc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,6-di-O-benzoyl-2,4-dideoxy-D-threo-hexopyranose |
| 3,6-Di-O-benzoyl-2,4-dideoxyhexopyranose |
| 3,6-Dob-2,4-ddhp |