methyl 2-[(2-chloroacetyl)amino]-3-(1h-indol-3-yl)propanoate structure
|
Common Name | methyl 2-[(2-chloroacetyl)amino]-3-(1h-indol-3-yl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 108273-71-8 | Molecular Weight | 294.73400 | |
| Density | 1.328g/cm3 | Boiling Point | 538ºC at 760mmHg | |
| Molecular Formula | C14H15ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.2ºC | |
| Name | methyl 2-[(2-chloroacetyl)amino]-3-(1h-indol-3-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 538ºC at 760mmHg |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.73400 |
| Flash Point | 279.2ºC |
| Exact Mass | 294.07700 |
| PSA | 71.19000 |
| LogP | 1.99790 |
| Vapour Pressure | 1.21E-11mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | KDURQOJTVSURJA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CCl |
| HS Code | 2933990090 |
|---|
|
~77%
methyl 2-[(2-ch... CAS#:108273-71-8 |
| Literature: Khandelwal; Jain; Anand Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1990 , vol. 29, # 2 p. 197 - 199 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (N-chloroacetyl)tryptophan methyl ester |
| L-Tryptophan,N-(2-chloroacetyl)-,methyl ester |