Methyl (2S)-amino(4-chlorophenyl)acetate hydrochloride (1:1)
Modify Date: 2025-09-27 18:25:12
Methyl (2S)-amino(4-chlorophenyl)acetate hydrochloride (1:1) structure
|
Common Name | Methyl (2S)-amino(4-chlorophenyl)acetate hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 1081766-09-7 | Molecular Weight | 236.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl (2S)-amino(4-chlorophenyl)acetate hydrochloride (1:1) |
|---|
| Molecular Formula | C9H11Cl2NO2 |
|---|---|
| Molecular Weight | 236.09500 |
| Exact Mass | 235.01700 |
| PSA | 52.32000 |
| LogP | 3.01510 |
| InChIKey | SLFXIBKUZFTNJA-QRPNPIFTSA-N |
| SMILES | COC(=O)C(N)c1ccc(Cl)cc1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |