1-(1-hydroxynaphthalen-2-yl)-3-(3-nitrophenyl)prop-2-en-1-one
Modify Date: 2025-09-04 08:00:48
1-(1-hydroxynaphthalen-2-yl)-3-(3-nitrophenyl)prop-2-en-1-one structure
|
Common Name | 1-(1-hydroxynaphthalen-2-yl)-3-(3-nitrophenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 108124-52-3 | Molecular Weight | 319.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1-hydroxynaphthalen-2-yl)-3-(3-nitrophenyl)prop-2-en-1-one |
|---|
| Molecular Formula | C19H13NO4 |
|---|---|
| Molecular Weight | 319.31100 |
| Exact Mass | 319.08400 |
| PSA | 83.12000 |
| LogP | 4.87290 |
| InChIKey | JALZPTHFPCBWAX-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)c1ccc2ccccc2c1O |
|
~%
1-(1-hydroxynap... CAS#:108124-52-3 |
| Literature: Torrey; Cardarelli Journal of the American Chemical Society, 1910 , vol. 32, p. 1482 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |