2-Chloro-N-(2-chloro-5-nitrophenyl)acetamide structure
|
Common Name | 2-Chloro-N-(2-chloro-5-nitrophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 108086-37-9 | Molecular Weight | 249.05100 | |
| Density | 1.579g/cm3 | Boiling Point | 422.3ºC at 760 mmHg | |
| Molecular Formula | C8H6Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.2ºC | |
| Name | 2-Chloro-N-(2-chloro-5-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.579g/cm3 |
|---|---|
| Boiling Point | 422.3ºC at 760 mmHg |
| Molecular Formula | C8H6Cl2N2O3 |
| Molecular Weight | 249.05100 |
| Flash Point | 209.2ºC |
| Exact Mass | 247.97600 |
| PSA | 74.92000 |
| LogP | 3.02170 |
| Vapour Pressure | 2.44E-07mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | ORRONSFAPOXMAG-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1cc([N+](=O)[O-])ccc1Cl |
| HS Code | 2924299090 |
|---|
|
~94%
2-Chloro-N-(2-c... CAS#:108086-37-9 |
| Literature: De Castro, Sonia; Chicharro, Roberto; Aran, Vicente J. Journal of the Chemical Society. Perkin Transactions 1, 2002 , # 6 p. 790 - 802 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2'-dichloro-5'-nitroacetanilide |