Ganoderic acid Mf structure
|
Common Name | Ganoderic acid Mf | ||
|---|---|---|---|---|
| CAS Number | 108026-94-4 | Molecular Weight | 512.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H48O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ganoderic acid MfGanoderic acid Mf is an antitumor triterpenoid. Ganoderic acid Mf causes cell cycle arrest in the G1 phase. Ganoderic acid Mf shows high selectivity between normal and cancer cells and induces cell apoptosis via mitochondria mediated pathway[1]. |
| Name | Ganoderic acid Mf |
|---|
| Description | Ganoderic acid Mf is an antitumor triterpenoid. Ganoderic acid Mf causes cell cycle arrest in the G1 phase. Ganoderic acid Mf shows high selectivity between normal and cancer cells and induces cell apoptosis via mitochondria mediated pathway[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C32H48O5 |
|---|---|
| Molecular Weight | 512.72 |
| InChIKey | NXZJPJLQVAKBTH-RGVLZGJSSA-N |
| SMILES | CC(=O)OC1CCC2(C)C3=CCC4(C)C(C(C)CCC=C(C)C(=O)O)CC(O)C4(C)C3=CCC2C1(C)C |