1-(2,4-dimethyl-phenyl)-pyrrole-2,5-dione
Modify Date: 2025-08-25 16:55:31
1-(2,4-dimethyl-phenyl)-pyrrole-2,5-dione structure
|
Common Name | 1-(2,4-dimethyl-phenyl)-pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 1080-52-0 | Molecular Weight | 201.22100 | |
| Density | 1.235g/cm3 | Boiling Point | 343ºC at 760mmHg | |
| Molecular Formula | C12H11NO2 | Melting Point | 188.6 °C | |
| MSDS | N/A | Flash Point | 155ºC | |
| Name | 1-(2,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 343ºC at 760mmHg |
| Melting Point | 188.6 °C |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22100 |
| Flash Point | 155ºC |
| Exact Mass | 201.07900 |
| PSA | 37.38000 |
| LogP | 1.79780 |
| Vapour Pressure | 7.27E-05mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | LWFUFCYGHRBLDH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2C(=O)C=CC2=O)c(C)c1 |
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 2925190090 |
|
~%
1-(2,4-dimethyl... CAS#:1080-52-0 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 145,147 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4-Dimethylphenylmaleimide |
| MFCD00030661 |