ethyl 1-bromoisoquinoline-3-carboxylate
Modify Date: 2025-09-18 18:26:23
ethyl 1-bromoisoquinoline-3-carboxylate structure
|
Common Name | ethyl 1-bromoisoquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1079947-40-2 | Molecular Weight | 280.11700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 1-bromoisoquinoline-3-carboxylate |
|---|
| Molecular Formula | C12H10BrNO2 |
|---|---|
| Molecular Weight | 280.11700 |
| Exact Mass | 278.98900 |
| PSA | 39.19000 |
| LogP | 3.17400 |
| InChIKey | XZQAFRMHJRYNCC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2ccccc2c(Br)n1 |
| HS Code | 2933499090 |
|---|
|
~%
ethyl 1-bromois... CAS#:1079947-40-2 |
| Literature: Guillou, Sandrine; Janin, Yves L. Journal of Heterocyclic Chemistry, 2008 , vol. 45, # 5 p. 1377 - 1384 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |