(2S,3R)-1,3-bis(4-chlorophenyl)-2-(4-fluorophenyl)-4-(1,2,4-triazol-1-yl)butane-2,3-diol
Modify Date: 2025-08-26 13:16:40
(2S,3R)-1,3-bis(4-chlorophenyl)-2-(4-fluorophenyl)-4-(1,2,4-triazol-1-yl)butane-2,3-diol structure
|
Common Name | (2S,3R)-1,3-bis(4-chlorophenyl)-2-(4-fluorophenyl)-4-(1,2,4-triazol-1-yl)butane-2,3-diol | ||
|---|---|---|---|---|
| CAS Number | 107680-30-8 | Molecular Weight | 472.33900 | |
| Density | 1.34g/cm3 | Boiling Point | 672.4ºC at 760mmHg | |
| Molecular Formula | C24H20Cl2FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.5ºC | |
| Name | (2S,3R)-1,3-bis(4-chlorophenyl)-2-(4-fluorophenyl)-4-(1,2,4-triazol-1-yl)butane-2,3-diol |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 672.4ºC at 760mmHg |
| Molecular Formula | C24H20Cl2FN3O2 |
| Molecular Weight | 472.33900 |
| Flash Point | 360.5ºC |
| Exact Mass | 471.09200 |
| PSA | 71.17000 |
| LogP | 4.74230 |
| Vapour Pressure | 5.35E-19mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | ZGNSDERFLLYPCZ-ZEQRLZLVSA-N |
| SMILES | OC(Cc1ccc(Cl)cc1)(c1ccc(F)cc1)C(O)(Cn1cncn1)c1ccc(Cl)cc1 |
|
~38%
(2S,3R)-1,3-bis... CAS#:107680-30-8 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |