(4S,5R)-4-(2-chlorophenyl)-5-(4-methylphenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one
Modify Date: 2025-09-22 13:45:29
(4S,5R)-4-(2-chlorophenyl)-5-(4-methylphenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one structure
|
Common Name | (4S,5R)-4-(2-chlorophenyl)-5-(4-methylphenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one | ||
|---|---|---|---|---|
| CAS Number | 107659-78-9 | Molecular Weight | 369.80200 | |
| Density | 1.37g/cm3 | Boiling Point | 603.1ºC at 760 mmHg | |
| Molecular Formula | C19H16ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.5ºC | |
| Name | (4S,5R)-4-(2-chlorophenyl)-5-(4-methylphenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 603.1ºC at 760 mmHg |
| Molecular Formula | C19H16ClN3O3 |
| Molecular Weight | 369.80200 |
| Flash Point | 318.5ºC |
| Exact Mass | 369.08800 |
| PSA | 66.24000 |
| LogP | 4.04350 |
| Vapour Pressure | 1.7E-14mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | FSNIDGWRLPJZGU-IEBWSBKVSA-N |
| SMILES | Cc1ccc(C2OC(=O)OC2(Cn2cncn2)c2ccccc2Cl)cc1 |
|
~%
(4S,5R)-4-(2-ch... CAS#:107659-78-9 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
|
~%
(4S,5R)-4-(2-ch... CAS#:107659-78-9 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
|
~%
(4S,5R)-4-(2-ch... CAS#:107659-78-9 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |