(2R,3R)-2-(4-chlorophenyl)-4-methyl-1-(1,2,4-triazol-1-yl)pentane-2,3-diol
Modify Date: 2025-08-21 12:43:52
(2R,3R)-2-(4-chlorophenyl)-4-methyl-1-(1,2,4-triazol-1-yl)pentane-2,3-diol structure
|
Common Name | (2R,3R)-2-(4-chlorophenyl)-4-methyl-1-(1,2,4-triazol-1-yl)pentane-2,3-diol | ||
|---|---|---|---|---|
| CAS Number | 107659-57-4 | Molecular Weight | 295.76500 | |
| Density | 1.29g/cm3 | Boiling Point | 511.4ºC at 760 mmHg | |
| Molecular Formula | C14H18ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1ºC | |
| Name | (2R,3R)-2-(4-chlorophenyl)-4-methyl-1-(1,2,4-triazol-1-yl)pentane-2,3-diol |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 511.4ºC at 760 mmHg |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.76500 |
| Flash Point | 263.1ºC |
| Exact Mass | 295.10900 |
| PSA | 71.17000 |
| LogP | 1.83620 |
| Vapour Pressure | 2.79E-11mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | YFOSESWIEOHSDT-KGLIPLIRSA-N |
| SMILES | CC(C)C(O)C(O)(Cn1cncn1)c1ccc(Cl)cc1 |
|
~17%
(2R,3R)-2-(4-ch... CAS#:107659-57-4 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
|
~%
(2R,3R)-2-(4-ch... CAS#:107659-57-4 |
| Literature: Ogata; Matsumoto; Takahashi; Shimizu; Kida; Murabayashi; Shiro; Tawara Journal of Medicinal Chemistry, 1987 , vol. 30, # 6 p. 1054 - 1068 |
![5-amino-4-cyano-2,3-dihydro-1H-benz[e]indene structure](https://image.chemsrc.com/caspic/064/65248-53-5.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |