6-Benzyl-5,7-dioxo-hexahydropyrrolo[3,4-b]pyridine structure
|
Common Name | 6-Benzyl-5,7-dioxo-hexahydropyrrolo[3,4-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 1076198-93-0 | Molecular Weight | 242.273 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 435.8±44.0 °C at 760 mmHg | |
| Molecular Formula | C14H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.4±28.4 °C | |
| Name | 6-Benzyl-1,2,3,4-tetrahydro-6H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 435.8±44.0 °C at 760 mmHg |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.273 |
| Flash Point | 217.4±28.4 °C |
| Exact Mass | 242.105530 |
| PSA | 49.41000 |
| LogP | 1.70 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | JJFNYKMZELJLBL-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(NCCC2)C(=O)N1Cc1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Benzyl-3,4-dihydro-1H-pyrrolo[3,4-b]pyridine-5,7(2H,6H)-dione |
| 1H-Pyrrolo[3,4-b]pyridine-5,7(2H,6H)-dione, 3,4-dihydro-6-(phenylmethyl)- |
| 6-benzyl-1,2,3,4-tetrahydropyrrolo[3,4-b]pyridine-5,7-dione |