[(2S,5R)-5-(2-aminopurin-9-yl)oxolan-2-yl]methanol structure
|
Common Name | [(2S,5R)-5-(2-aminopurin-9-yl)oxolan-2-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 107550-74-3 | Molecular Weight | 235.24300 | |
| Density | 1.76g/cm3 | Boiling Point | 570.8ºC at 760mmHg | |
| Molecular Formula | C10H13N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299ºC | |
| Name | [(2S,5R)-5-(2-aminopurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76g/cm3 |
|---|---|
| Boiling Point | 570.8ºC at 760mmHg |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.24300 |
| Flash Point | 299ºC |
| Exact Mass | 235.10700 |
| PSA | 99.81000 |
| LogP | 0.00850 |
| Vapour Pressure | 7.23E-14mmHg at 25°C |
| Index of Refraction | 1.822 |
| InChIKey | HXUIKBBUGWIQMV-POYBYMJQSA-N |
| SMILES | Nc1ncc2ncn(C3CCC(CO)O3)c2n1 |
|
~43%
[(2S,5R)-5-(2-a... CAS#:107550-74-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 5 p. 1606 - 1612 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Amino-ddP |
| iso-2',3'-dideoxyadenosine |